5,6,7-trimethoxyphenanthrene-3-carboxylic acid

C18H16O5 — CID 174758536

IUPAC5,6,7-trimethoxyphenanthrene-3-carboxylic acid
SMILESCOc1cc2ccc3ccc(C(=O)O)cc3c2c(OC)c1OC
InChIInChI=1S/C18H16O5/c1-21-14-9-11-6-4-10-5-7-12(18(19)20)8-13(10)15(11)17(23-3)16(14)22-2/h4-9H,1-3H3,(H,19,20)
InChIKeyOUTCSYBJGJDPPJ-UHFFFAOYSA-N
MW312.32 g/mol
LogP3.72
Rot. Bonds4

About 5,6,7-trimethoxyphenanthrene-3-carboxylic acid

5,6,7-trimethoxyphenanthrene-3-carboxylic acid (PubChem CID 174758536) has the molecular formula C18H16O5 and a molecular weight of 312.32 g/mol. Its IUPAC name is 5,6,7-trimethoxyphenanthrene-3-carboxylic acid.

Molecular Properties

Compound Name5,6,7-trimethoxyphenanthrene-3-carboxylic acid
PubChem CID174758536
Molecular FormulaC18H16O5
Molecular Weight312.32 g/mol
Exact Mass312.10
IUPAC Name5,6,7-trimethoxyphenanthrene-3-carboxylic acid
SMILESCOc1cc2ccc3ccc(C(=O)O)cc3c2c(OC)c1OC
InChIInChI=1S/C18H16O5/c1-21-14-9-11-6-4-10-5-7-12(18(19)20)8-13(10)15(11)17(23-3)16(14)22-2/h4-9H,1-3H3,(H,19,20)
InChIKeyOUTCSYBJGJDPPJ-UHFFFAOYSA-N
XLogP3.72
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500312.32
LogP ≤ 53.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}

Analyze 5,6,7-trimethoxyphenanthrene-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6,7-trimethoxyphenanthrene-3-carboxylic acid?
The IUPAC name of 5,6,7-trimethoxyphenanthrene-3-carboxylic acid (CID 174758536) is 5,6,7-trimethoxyphenanthrene-3-carboxylic acid.
What is the SMILES notation for 5,6,7-trimethoxyphenanthrene-3-carboxylic acid?
The canonical SMILES for 5,6,7-trimethoxyphenanthrene-3-carboxylic acid is COc1cc2ccc3ccc(C(=O)O)cc3c2c(OC)c1OC.
What is the InChIKey of 5,6,7-trimethoxyphenanthrene-3-carboxylic acid?
The InChIKey is OUTCSYBJGJDPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16O5/c1-21-14-9-11-6-4-10-5-7-12(18(19)20)8-13(10)15(11)17(23-3)16(14)22-2/h4-9H,1-3H3,(H,19,20).
What are the key properties of 5,6,7-trimethoxyphenanthrene-3-carboxylic acid?
5,6,7-trimethoxyphenanthrene-3-carboxylic acid has a molecular weight of 312.32 g/mol, XLogP of 3.72, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6,7-trimethoxyphenanthrene-3-carboxylic acid is sourced from PubChem (CID 174758536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).