C38H36O12 — CID 141397610
3,4,6,7-tetramethoxyphenanthrene-9-carboxylic acid (PubChem CID 141397610) has the molecular formula C38H36O12 and a molecular weight of 684.69 g/mol. Its IUPAC name is 3,4,6,7-tetramethoxyphenanthrene-9-carboxylic acid.
| Compound Name | 3,4,6,7-tetramethoxyphenanthrene-9-carboxylic acid |
|---|---|
| PubChem CID | 141397610 |
| Molecular Formula | C38H36O12 |
| Molecular Weight | 684.69 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | 3,4,6,7-tetramethoxyphenanthrene-9-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)cc3ccc(OC)c(OC)c3c2cc1OC.COc1cc2c(C(=O)O)cc3ccc(OC)c(OC)c3c2cc1OC |
| InChI | InChI=1S/2C19H18O6/c2*1-22-14-6-5-10-7-13(19(20)21)11-8-15(23-2)16(24-3)9-12(11)17(10)18(14)25-4/h2*5-9H,1-4H3,(H,20,21) |
| InChIKey | NVLLWMQWIRSYBA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.69 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|