C18H14O6 — CID 141238294
9,10-dimethoxynaphtho[2,1-g][1,3]benzodioxole-7-carboxylic acid (PubChem CID 141238294) has the molecular formula C18H14O6 and a molecular weight of 326.30 g/mol. Its IUPAC name is 9,10-dimethoxynaphtho[2,1-g][1,3]benzodioxole-7-carboxylic acid.
| Compound Name | 9,10-dimethoxynaphtho[2,1-g][1,3]benzodioxole-7-carboxylic acid |
|---|---|
| PubChem CID | 141238294 |
| Molecular Formula | C18H14O6 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 9,10-dimethoxynaphtho[2,1-g][1,3]benzodioxole-7-carboxylic acid |
| SMILES | COc1cc2c(C(=O)O)cc3ccc4c(c3c2cc1OC)OCO4 |
| InChI | InChI=1S/C18H14O6/c1-21-14-6-10-11(7-15(14)22-2)16-9(5-12(10)18(19)20)3-4-13-17(16)24-8-23-13/h3-7H,8H2,1-2H3,(H,19,20) |
| InChIKey | VLXZVWZPCQXJOS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|