C23H26O10 — CID 15680274
2-methoxyethyl 4-[4,5-dimethoxy-2-(2-methoxyethoxycarbonyl)phenyl]-1,3-benzodioxole-5-carboxylate (PubChem CID 15680274) has the molecular formula C23H26O10 and a molecular weight of 462.45 g/mol. Its IUPAC name is 2-methoxyethyl 4-[4,5-dimethoxy-2-(2-methoxyethoxycarbonyl)phenyl]-1,3-benzodioxole-5-carboxylate.
| Compound Name | 2-methoxyethyl 4-[4,5-dimethoxy-2-(2-methoxyethoxycarbonyl)phenyl]-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 15680274 |
| Molecular Formula | C23H26O10 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 2-methoxyethyl 4-[4,5-dimethoxy-2-(2-methoxyethoxycarbonyl)phenyl]-1,3-benzodioxole-5-carboxylate |
| SMILES | COCCOC(=O)c1cc(OC)c(OC)cc1-c1c(C(=O)OCCOC)ccc2c1OCO2 |
| InChI | InChI=1S/C23H26O10/c1-26-7-9-30-22(24)14-5-6-17-21(33-13-32-17)20(14)15-11-18(28-3)19(29-4)12-16(15)23(25)31-10-8-27-2/h5-6,11-12H,7-10,13H2,1-4H3 |
| InChIKey | BTMXSEJBJZVVHS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|