C20H19BrNO5+ — CID 10554883
(4-bromo-1,3-benzodioxol-5-yl)-(6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)methanone (PubChem CID 10554883) has the molecular formula C20H19BrNO5+ and a molecular weight of 433.28 g/mol. Its IUPAC name is (4-bromo-1,3-benzodioxol-5-yl)-(6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)methanone.
| Compound Name | (4-bromo-1,3-benzodioxol-5-yl)-(6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)methanone |
|---|---|
| PubChem CID | 10554883 |
| Molecular Formula | C20H19BrNO5+ |
| Molecular Weight | 433.28 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (4-bromo-1,3-benzodioxol-5-yl)-(6,7-dimethoxy-2-methyl-3,4-dihydroisoquinolin-2-ium-1-yl)methanone |
| SMILES | COc1cc2c(cc1OC)C(C(=O)c1ccc3c(c1Br)OCO3)=[N+](C)CC2 |
| InChI | InChI=1S/C20H19BrNO5/c1-22-7-6-11-8-15(24-2)16(25-3)9-13(11)18(22)19(23)12-4-5-14-20(17(12)21)27-10-26-14/h4-5,8-9H,6-7,10H2,1-3H3/q+1 |
| InChIKey | XEOZBNOQBXVMAI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 57.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.28 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|