C16H12O8 — CID 630392
7-(4-carboxy-2-methoxyphenoxy)-1,3-benzodioxole-5-carboxylic acid (PubChem CID 630392) has the molecular formula C16H12O8 and a molecular weight of 332.26 g/mol. Its IUPAC name is 7-(4-carboxy-2-methoxyphenoxy)-1,3-benzodioxole-5-carboxylic acid.
| Compound Name | 7-(4-carboxy-2-methoxyphenoxy)-1,3-benzodioxole-5-carboxylic acid |
|---|---|
| PubChem CID | 630392 |
| Molecular Formula | C16H12O8 |
| Molecular Weight | 332.26 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 7-(4-carboxy-2-methoxyphenoxy)-1,3-benzodioxole-5-carboxylic acid |
| SMILES | COc1cc(C(=O)O)ccc1Oc1cc(C(=O)O)cc2c1OCO2 |
| InChI | InChI=1S/C16H12O8/c1-21-11-4-8(15(17)18)2-3-10(11)24-13-6-9(16(19)20)5-12-14(13)23-7-22-12/h2-6H,7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | QXFGHMTZZDRUQP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |