About 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid
5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid (PubChem CID 156872680) has the molecular formula C12H14O5
and a molecular weight of 238.24 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid.
Analyze 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid?
The IUPAC name of 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid (CID 156872680) is 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid.
What is the SMILES notation for 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid?
The canonical SMILES for 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid is COc1cc(C(=O)O)cc2c1OCC(C)(C)O2.
What is the InChIKey of 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid?
The InChIKey is XTXBQXTXNVCTGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O5/c1-12(2)6-16-10-8(15-3)4-7(11(13)14)5-9(10)17-12/h4-5H,6H2,1-3H3,(H,13,14).
What are the key properties of 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid?
5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid has a molecular weight of 238.24 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,2-dimethyl-3H-1,4-benzodioxine-7-carboxylic acid is sourced from PubChem (CID 156872680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).