C20H22N2O8 — CID 9273653
5-methoxy-N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide (PubChem CID 9273653) has the molecular formula C20H22N2O8 and a molecular weight of 418.40 g/mol. Its IUPAC name is 5-methoxy-N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide.
| Compound Name | 5-methoxy-N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
|---|---|
| PubChem CID | 9273653 |
| Molecular Formula | C20H22N2O8 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 5-methoxy-N'-(3,4,5-trimethoxybenzoyl)-2,3-dihydro-1,4-benzodioxine-7-carbohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)c2cc(OC)c3c(c2)OCCO3)cc(OC)c1OC |
| InChI | InChI=1S/C20H22N2O8/c1-25-13-7-11(8-14(26-2)17(13)28-4)19(23)21-22-20(24)12-9-15(27-3)18-16(10-12)29-5-6-30-18/h7-10H,5-6H2,1-4H3,(H,21,23)(H,22,24) |
| InChIKey | UKNZHNYVHZPKGU-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|