C16H14INO4 — CID 8777302
N-(4-iodophenyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxamide (PubChem CID 8777302) has the molecular formula C16H14INO4 and a molecular weight of 411.20 g/mol. Its IUPAC name is N-(4-iodophenyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxamide.
| Compound Name | N-(4-iodophenyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
|---|---|
| PubChem CID | 8777302 |
| Molecular Formula | C16H14INO4 |
| Molecular Weight | 411.20 g/mol |
| Exact Mass | 411.00 |
| IUPAC Name | N-(4-iodophenyl)-5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(I)cc2)cc2c1OCCO2 |
| InChI | InChI=1S/C16H14INO4/c1-20-13-8-10(9-14-15(13)22-7-6-21-14)16(19)18-12-4-2-11(17)3-5-12/h2-5,8-9H,6-7H2,1H3,(H,18,19) |
| InChIKey | QEBAURWFADGLMK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.20 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|