C19H27N3O4S — CID 11937262
1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]thiourea (PubChem CID 11937262) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]thiourea.
| Compound Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 11937262 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 1-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-3-[(5-methoxy-2,3-dihydro-1,4-benzodioxine-7-carbonyl)amino]thiourea |
| SMILES | COc1cc(C(=O)NNC(=S)N[C@H]2CCC[C@@H](C)[C@H]2C)cc2c1OCCO2 |
| InChI | InChI=1S/C19H27N3O4S/c1-11-5-4-6-14(12(11)2)20-19(27)22-21-18(23)13-9-15(24-3)17-16(10-13)25-7-8-26-17/h9-12,14H,4-8H2,1-3H3,(H,21,23)(H2,20,22,27)/t11-,12-,14+/m1/s1 |
| InChIKey | MIBPKZKPZBVIPT-BZPMIXESSA-N |
| XLogP | 2.40 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|