C18H27N3O3S — CID 11946300
1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea (PubChem CID 11946300) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is 1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea.
| Compound Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 11946300 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R,3S)-2,3-dimethylcyclohexyl]thiourea |
| SMILES | COc1ccc(C(=O)NNC(=S)N[C@@H]2CCC[C@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C18H27N3O3S/c1-11-6-5-7-14(12(11)2)19-18(25)21-20-17(22)13-8-9-15(23-3)16(10-13)24-4/h8-12,14H,5-7H2,1-4H3,(H,20,22)(H2,19,21,25)/t11-,12+,14+/m0/s1 |
| InChIKey | DSQIBQILKOSZCQ-OUCADQQQSA-N |
| XLogP | 2.64 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|