C17H25N3O3S — CID 8625077
1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8625077) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8625077 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[(3,4-dimethoxybenzoyl)amino]-3-[(1R,2R)-2-methylcyclohexyl]thiourea |
| SMILES | COc1ccc(C(=O)NNC(=S)N[C@@H]2CCCC[C@H]2C)cc1OC |
| InChI | InChI=1S/C17H25N3O3S/c1-11-6-4-5-7-13(11)18-17(24)20-19-16(21)12-8-9-14(22-2)15(10-12)23-3/h8-11,13H,4-7H2,1-3H3,(H,19,21)(H2,18,20,24)/t11-,13-/m1/s1 |
| InChIKey | QTTQZIIUNBMAMF-DGCLKSJQSA-N |
| XLogP | 2.39 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|