C18H27N3O2S — CID 8742262
1-[(1S,2R)-2-methylcyclohexyl]-3-[(4-propan-2-yloxybenzoyl)amino]thiourea (PubChem CID 8742262) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-[(4-propan-2-yloxybenzoyl)amino]thiourea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(4-propan-2-yloxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 8742262 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-[(4-propan-2-yloxybenzoyl)amino]thiourea |
| SMILES | CC(C)Oc1ccc(C(=O)NNC(=S)N[C@H]2CCCC[C@H]2C)cc1 |
| InChI | InChI=1S/C18H27N3O2S/c1-12(2)23-15-10-8-14(9-11-15)17(22)20-21-18(24)19-16-7-5-4-6-13(16)3/h8-13,16H,4-7H2,1-3H3,(H,20,22)(H2,19,21,24)/t13-,16+/m1/s1 |
| InChIKey | PYHCFBBPDBGHIK-CJNGLKHVSA-N |
| XLogP | 3.16 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|