C18H24N4O2S — CID 8768879
1-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea (PubChem CID 8768879) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 1-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea.
| Compound Name | 1-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
|---|---|
| PubChem CID | 8768879 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 1-[[(2R)-2-(4-cyanophenoxy)propanoyl]amino]-3-[(1S,2R)-2-methylcyclohexyl]thiourea |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NNC(=O)[C@@H](C)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C18H24N4O2S/c1-12-5-3-4-6-16(12)20-18(25)22-21-17(23)13(2)24-15-9-7-14(11-19)8-10-15/h7-10,12-13,16H,3-6H2,1-2H3,(H,21,23)(H2,20,22,25)/t12-,13-,16+/m1/s1 |
| InChIKey | OOZWXAYFAVVJSD-IOASZLSFSA-N |
| XLogP | 2.40 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|