C18H24N2O2 — CID 11929296
(2R)-2-(3-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 11929296) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R)-2-(3-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2R)-2-(3-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 11929296 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (2R)-2-(3-cyanophenoxy)-N-[(1S,2R,3S)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@H]1[C@@H](NC(=O)[C@@H](C)Oc2cccc(C#N)c2)CCC[C@@H]1C |
| InChI | InChI=1S/C18H24N2O2/c1-12-6-4-9-17(13(12)2)20-18(21)14(3)22-16-8-5-7-15(10-16)11-19/h5,7-8,10,12-14,17H,4,6,9H2,1-3H3,(H,20,21)/t12-,13+,14+,17-/m0/s1 |
| InChIKey | BMWSXRANLKYJBC-CFAJVAMVSA-N |
| XLogP | 3.27 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |