C17H24FNO2 — CID 78853035
N-(2,6-dimethylcyclohexyl)-2-(3-fluorophenoxy)propanamide (PubChem CID 78853035) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is N-(2,6-dimethylcyclohexyl)-2-(3-fluorophenoxy)propanamide.
| Compound Name | N-(2,6-dimethylcyclohexyl)-2-(3-fluorophenoxy)propanamide |
|---|---|
| PubChem CID | 78853035 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-(2,6-dimethylcyclohexyl)-2-(3-fluorophenoxy)propanamide |
| SMILES | CC(Oc1cccc(F)c1)C(=O)NC1C(C)CCCC1C |
| InChI | InChI=1S/C17H24FNO2/c1-11-6-4-7-12(2)16(11)19-17(20)13(3)21-15-9-5-8-14(18)10-15/h5,8-13,16H,4,6-7H2,1-3H3,(H,19,20) |
| InChIKey | ZTEKSXMGOPBRHK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |