C16H20N2O — CID 11920013
3-cyano-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]benzamide (PubChem CID 11920013) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3-cyano-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]benzamide.
| Compound Name | 3-cyano-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]benzamide |
|---|---|
| PubChem CID | 11920013 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-cyano-N-[(1R,2R,3R)-2,3-dimethylcyclohexyl]benzamide |
| SMILES | C[C@@H]1[C@H](C)CCC[C@H]1NC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C16H20N2O/c1-11-5-3-8-15(12(11)2)18-16(19)14-7-4-6-13(9-14)10-17/h4,6-7,9,11-12,15H,3,5,8H2,1-2H3,(H,18,19)/t11-,12-,15-/m1/s1 |
| InChIKey | BFASONIKWMNDHB-LALPHHSUSA-N |
| XLogP | 3.11 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |