C18H20N2O — CID 43066723
3-cyano-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 43066723) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 3-cyano-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | 3-cyano-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 43066723 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-cyano-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | N#Cc1cccc(C(=O)NC2CC3CC2C2CCCC32)c1 |
| InChI | InChI=1S/C18H20N2O/c19-10-11-3-1-4-12(7-11)18(21)20-17-9-13-8-16(17)15-6-2-5-14(13)15/h1,3-4,7,13-17H,2,5-6,8-9H2,(H,20,21) |
| InChIKey | LKBLYMPHWWZXOI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |