C22H28N2O2 — CID 124791514
3-[(2-oxopyrrolidin-1-yl)methyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]benzamide (PubChem CID 124791514) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[(2-oxopyrrolidin-1-yl)methyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]benzamide.
| Compound Name | 3-[(2-oxopyrrolidin-1-yl)methyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]benzamide |
|---|---|
| PubChem CID | 124791514 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-[(2-oxopyrrolidin-1-yl)methyl]-N-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]benzamide |
| SMILES | O=C(N[C@@H]1C[C@H]2C[C@H]1[C@H]1CCC[C@H]21)c1cccc(CN2CCCC2=O)c1 |
| InChI | InChI=1S/C22H28N2O2/c25-21-8-3-9-24(21)13-14-4-1-5-15(10-14)22(26)23-20-12-16-11-19(20)18-7-2-6-17(16)18/h1,4-5,10,16-20H,2-3,6-9,11-13H2,(H,23,26)/t16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | DPELPGGWHRAUIZ-SWBPCFCJSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |