C18H24N2O — CID 43710188
4-(aminomethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide (PubChem CID 43710188) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide.
| Compound Name | 4-(aminomethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
|---|---|
| PubChem CID | 43710188 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 4-(aminomethyl)-N-(8-tricyclo[5.2.1.02,6]decanyl)benzamide |
| SMILES | NCc1ccc(C(=O)NC2CC3CC2C2CCCC32)cc1 |
| InChI | InChI=1S/C18H24N2O/c19-10-11-4-6-12(7-5-11)18(21)20-17-9-13-8-16(17)15-3-1-2-14(13)15/h4-7,13-17H,1-3,8-10,19H2,(H,20,21) |
| InChIKey | AQRHLCFJHOVUPW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |