C18H23NO2 — CID 65347724
4-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]benzoic acid (PubChem CID 65347724) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]benzoic acid.
| Compound Name | 4-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 65347724 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 4-[(8-tricyclo[5.2.1.02,6]decanylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC2CC3CC2C2CCCC32)cc1 |
| InChI | InChI=1S/C18H23NO2/c20-18(21)12-6-4-11(5-7-12)10-19-17-9-13-8-16(17)15-3-1-2-14(13)15/h4-7,13-17,19H,1-3,8-10H2,(H,20,21) |
| InChIKey | UEELBFTVHITKSV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |