C22H29N3O2 — CID 124839022
1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (PubChem CID 124839022) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea.
| Compound Name | 1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
|---|---|
| PubChem CID | 124839022 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[[4-(2-oxopyrrolidin-1-yl)phenyl]methyl]-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| SMILES | O=C(NCc1ccc(N2CCCC2=O)cc1)N[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C22H29N3O2/c26-21-5-2-10-25(21)16-8-6-14(7-9-16)13-23-22(27)24-20-12-15-11-19(20)18-4-1-3-17(15)18/h6-9,15,17-20H,1-5,10-13H2,(H2,23,24,27)/t15-,17+,18-,19+,20-/m1/s1 |
| InChIKey | NIRRUTXNLBBEDI-MTEHYEEQSA-N |
| XLogP | 3.44 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |