C20H28N2O3 — CID 124735238
1-[(3,4-dimethoxyphenyl)methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (PubChem CID 124735238) has the molecular formula C20H28N2O3 and a molecular weight of 344.45 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
|---|---|
| PubChem CID | 124735238 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[(1R,2R,6S,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| SMILES | COc1ccc(CNC(=O)N[C@@H]2C[C@H]3C[C@H]2[C@H]2CCC[C@H]32)cc1OC |
| InChI | InChI=1S/C20H28N2O3/c1-24-18-7-6-12(8-19(18)25-2)11-21-20(23)22-17-10-13-9-16(17)15-5-3-4-14(13)15/h6-8,13-17H,3-5,9-11H2,1-2H3,(H2,21,22,23)/t13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | NLGCAAVFNFBPNJ-UHDSXZAQSA-N |
| XLogP | 3.33 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |