C21H32N2O4 — CID 95784357
1-[(3,4-dimethoxyphenyl)methyl]-3-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]urea (PubChem CID 95784357) has the molecular formula C21H32N2O4 and a molecular weight of 376.50 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]urea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]urea |
|---|---|
| PubChem CID | 95784357 |
| Molecular Formula | C21H32N2O4 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-[(1S,3S)-3-ethoxyspiro[3.5]nonan-1-yl]urea |
| SMILES | CCO[C@H]1C[C@H](NC(=O)NCc2ccc(OC)c(OC)c2)C12CCCCC2 |
| InChI | InChI=1S/C21H32N2O4/c1-4-27-19-13-18(21(19)10-6-5-7-11-21)23-20(24)22-14-15-8-9-16(25-2)17(12-15)26-3/h8-9,12,18-19H,4-7,10-11,13-14H2,1-3H3,(H2,22,23,24)/t18-,19-/m0/s1 |
| InChIKey | BCKLWVAOCHTANI-OALUTQOASA-N |
| XLogP | 3.63 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |