C20H26N2O3 — CID 124741256
1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea (PubChem CID 124741256) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
|---|---|
| PubChem CID | 124741256 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-3-[(1R,2S,6R,7S,8R)-8-tricyclo[5.2.1.02,6]decanyl]urea |
| SMILES | O=C(NCc1ccc2c(c1)OCCO2)N[C@@H]1C[C@H]2C[C@H]1[C@@H]1CCC[C@@H]21 |
| InChI | InChI=1S/C20H26N2O3/c23-20(21-11-12-4-5-18-19(8-12)25-7-6-24-18)22-17-10-13-9-16(17)15-3-1-2-14(13)15/h4-5,8,13-17H,1-3,6-7,9-11H2,(H2,21,22,23)/t13-,14+,15-,16+,17-/m1/s1 |
| InChIKey | WAQBFMZEOXCYPA-BPKGMFCQSA-N |
| XLogP | 3.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |