C17H23N3O3 — CID 100856062
1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzodioxol-5-ylmethyl)urea (PubChem CID 100856062) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzodioxol-5-ylmethyl)urea.
| Compound Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzodioxol-5-ylmethyl)urea |
|---|---|
| PubChem CID | 100856062 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[(1R,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(1,3-benzodioxol-5-ylmethyl)urea |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)N[C@@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C17H23N3O3/c21-17(19-13-6-8-20-7-2-1-3-14(13)20)18-10-12-4-5-15-16(9-12)23-11-22-15/h4-5,9,13-14H,1-3,6-8,10-11H2,(H2,18,19,21)/t13-,14+/m1/s1 |
| InChIKey | CWVFVKJAXKYBAY-KGLIPLIRSA-N |
| XLogP | 1.84 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |