C17H22N2O4 — CID 133266993
2-(1,3-benzodioxol-5-yl)-N-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]acetamide (PubChem CID 133266993) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 133266993 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(3S,4S)-4-pyrrolidin-1-yloxolan-3-yl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N[C@@H]1COC[C@H]1N1CCCC1 |
| InChI | InChI=1S/C17H22N2O4/c20-17(8-12-3-4-15-16(7-12)23-11-22-15)18-13-9-21-10-14(13)19-5-1-2-6-19/h3-4,7,13-14H,1-2,5-6,8-11H2,(H,18,20)/t13-,14-/m1/s1 |
| InChIKey | MCAZONFZOKWWSC-ZIAGYGMSSA-N |
| XLogP | 0.94 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |