C16H21NO4 — CID 104956680
3-(1,3-benzodioxol-5-yl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide (PubChem CID 104956680) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide |
|---|---|
| PubChem CID | 104956680 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C16H21NO4/c18-13-4-2-1-3-12(13)17-16(19)8-6-11-5-7-14-15(9-11)21-10-20-14/h5,7,9,12-13,18H,1-4,6,8,10H2,(H,17,19)/t12-,13-/m0/s1 |
| InChIKey | PUZGCQJCRXSGBQ-STQMWFEESA-N |
| XLogP | 1.77 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |