C15H22N2O2 — CID 107211275
3-(3-aminophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide (PubChem CID 107211275) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-(3-aminophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide.
| Compound Name | 3-(3-aminophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide |
|---|---|
| PubChem CID | 107211275 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 3-(3-aminophenyl)-N-[(1S,2S)-2-hydroxycyclohexyl]propanamide |
| SMILES | Nc1cccc(CCC(=O)N[C@H]2CCCC[C@@H]2O)c1 |
| InChI | InChI=1S/C15H22N2O2/c16-12-5-3-4-11(10-12)8-9-15(19)17-13-6-1-2-7-14(13)18/h3-5,10,13-14,18H,1-2,6-9,16H2,(H,17,19)/t13-,14-/m0/s1 |
| InChIKey | DPPYPLDXXSZKCD-KBPBESRZSA-N |
| XLogP | 1.62 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|