C14H18N2O4 — CID 70722564
2-(1,3-benzodioxol-5-yl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]acetamide (PubChem CID 70722564) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 70722564 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(3R,4R)-3-hydroxypiperidin-4-yl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)N[C@@H]1CCNC[C@H]1O |
| InChI | InChI=1S/C14H18N2O4/c17-11-7-15-4-3-10(11)16-14(18)6-9-1-2-12-13(5-9)20-8-19-12/h1-2,5,10-11,15,17H,3-4,6-8H2,(H,16,18)/t10-,11-/m1/s1 |
| InChIKey | GHUITHXNCXRRIC-GHMZBOCLSA-N |
| XLogP | -0.20 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |