C13H14O3 — CID 168896088
2-(1,3-benzodioxol-5-yl)-1-cyclobutylethanone (PubChem CID 168896088) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-1-cyclobutylethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-1-cyclobutylethanone |
|---|---|
| PubChem CID | 168896088 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-1-cyclobutylethanone |
| SMILES | O=C(Cc1ccc2c(c1)OCO2)C1CCC1 |
| InChI | InChI=1S/C13H14O3/c14-11(10-2-1-3-10)6-9-4-5-12-13(7-9)16-8-15-12/h4-5,7,10H,1-3,6,8H2 |
| InChIKey | DESCCMZNDQWMCL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |