C20H27NO3 — CID 89407594
cyclohexanecarboxamide;5-(2-methylidenepent-3-enyl)-1,3-benzodioxole (PubChem CID 89407594) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is cyclohexanecarboxamide;5-(2-methylidenepent-3-enyl)-1,3-benzodioxole.
| Compound Name | cyclohexanecarboxamide;5-(2-methylidenepent-3-enyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 89407594 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | cyclohexanecarboxamide;5-(2-methylidenepent-3-enyl)-1,3-benzodioxole |
| SMILES | C=C(C=CC)Cc1ccc2c(c1)OCO2.NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H14O2.C7H13NO/c1-3-4-10(2)7-11-5-6-12-13(8-11)15-9-14-12;8-7(9)6-4-2-1-3-5-6/h3-6,8H,2,7,9H2,1H3;6H,1-5H2,(H2,8,9) |
| InChIKey | SYLJQYRVPNJAET-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|