C14H18N2O2 — CID 63174498
N'-(1,3-benzodioxol-5-ylmethyl)cyclopentanecarboximidamide (PubChem CID 63174498) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is N'-(1,3-benzodioxol-5-ylmethyl)cyclopentanecarboximidamide.
| Compound Name | N'-(1,3-benzodioxol-5-ylmethyl)cyclopentanecarboximidamide |
|---|---|
| PubChem CID | 63174498 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N'-(1,3-benzodioxol-5-ylmethyl)cyclopentanecarboximidamide |
| SMILES | N/C(=N\Cc1ccc2c(c1)OCO2)C1CCCC1 |
| InChI | InChI=1S/C14H18N2O2/c15-14(11-3-1-2-4-11)16-8-10-5-6-12-13(7-10)18-9-17-12/h5-7,11H,1-4,8-9H2,(H2,15,16) |
| InChIKey | IWPGHOFCWBWNLS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|