C8H7NO3 — CID 54405067
5-(nitrosomethyl)-1,3-benzodioxole (PubChem CID 54405067) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 5-(nitrosomethyl)-1,3-benzodioxole.
| Compound Name | 5-(nitrosomethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 54405067 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 5-(nitrosomethyl)-1,3-benzodioxole |
| SMILES | O=NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C8H7NO3/c10-9-4-6-1-2-7-8(3-6)12-5-11-7/h1-3H,4-5H2 |
| InChIKey | VQCQPDOAQIMFQN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |