About 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid
5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid (PubChem CID 63942980) has the molecular formula C13H10O5S
and a molecular weight of 278.28 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid.
Analyze 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid?
The IUPAC name of 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid (CID 63942980) is 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid.
What is the SMILES notation for 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid?
The canonical SMILES for 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid is O=C(O)c1ccc(SCc2ccc3c(c2)OCO3)o1.
What is the InChIKey of 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid?
The InChIKey is JOKFXKLQPMJLBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O5S/c14-13(15)10-3-4-12(18-10)19-6-8-1-2-9-11(5-8)17-7-16-9/h1-5H,6-7H2,(H,14,15).
What are the key properties of 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid?
5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid has a molecular weight of 278.28 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,3-benzodioxol-5-ylmethylsulfanyl)furan-2-carboxylic acid is sourced from PubChem (CID 63942980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).