C10H8O4S — CID 601441
3-(1,3-benzodioxol-5-yl)-2-sulfanylidenepropanoic acid (PubChem CID 601441) has the molecular formula C10H8O4S and a molecular weight of 224.24 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2-sulfanylidenepropanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2-sulfanylidenepropanoic acid |
|---|---|
| PubChem CID | 601441 |
| Molecular Formula | C10H8O4S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2-sulfanylidenepropanoic acid |
| SMILES | O=C(O)C(=S)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H8O4S/c11-10(12)9(15)4-6-1-2-7-8(3-6)14-5-13-7/h1-3H,4-5H2,(H,11,12) |
| InChIKey | BNXBSRIVZJUTID-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|