C11H12N2O4 — CID 11770451
2-(1,3-benzodioxol-5-yl)-N-(methylcarbamoyl)acetamide (PubChem CID 11770451) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-(methylcarbamoyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-(methylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 11770451 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-(methylcarbamoyl)acetamide |
| SMILES | CNC(=O)NC(=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12N2O4/c1-12-11(15)13-10(14)5-7-2-3-8-9(4-7)17-6-16-8/h2-4H,5-6H2,1H3,(H2,12,13,14,15) |
| InChIKey | YFASCMCWBCRLFT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |