C11H14N2O3 — CID 116847425
2-(1,3-benzodioxol-5-yl)-N',N'-dimethylacetohydrazide (PubChem CID 116847425) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N',N'-dimethylacetohydrazide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N',N'-dimethylacetohydrazide |
|---|---|
| PubChem CID | 116847425 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N',N'-dimethylacetohydrazide |
| SMILES | CN(C)NC(=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14N2O3/c1-13(2)12-11(14)6-8-3-4-9-10(5-8)16-7-15-9/h3-5H,6-7H2,1-2H3,(H,12,14) |
| InChIKey | GLTVHYHRSDEZNC-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|