C18H18N2O3 — CID 126050691
2-(1,3-benzodioxol-5-yl)-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide (PubChem CID 126050691) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 126050691 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(Z)-1-(4-methylphenyl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)Cc1ccc2c(c1)OCO2)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-12-3-6-15(7-4-12)13(2)19-20-18(21)10-14-5-8-16-17(9-14)23-11-22-16/h3-9H,10-11H2,1-2H3,(H,20,21)/b19-13- |
| InChIKey | VCEPSKGKHFYCAT-UYRXBGFRSA-N |
| XLogP | 2.81 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|