C25H28N4O6 — CID 4198413
N,N'-bis[1-(1,3-benzodioxol-5-yl)ethylideneamino]heptanediamide (PubChem CID 4198413) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is N,N'-bis[1-(1,3-benzodioxol-5-yl)ethylideneamino]heptanediamide.
| Compound Name | N,N'-bis[1-(1,3-benzodioxol-5-yl)ethylideneamino]heptanediamide |
|---|---|
| PubChem CID | 4198413 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N,N'-bis[1-(1,3-benzodioxol-5-yl)ethylideneamino]heptanediamide |
| SMILES | CC(=NNC(=O)CCCCCC(=O)NN=C(C)c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H28N4O6/c1-16(18-8-10-20-22(12-18)34-14-32-20)26-28-24(30)6-4-3-5-7-25(31)29-27-17(2)19-9-11-21-23(13-19)35-15-33-21/h8-13H,3-7,14-15H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | VMEMKYYJJHGRBF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|