C20H21ClN2O4 — CID 3355735
N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(4-chloro-2-methylphenoxy)butanamide (PubChem CID 3355735) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(4-chloro-2-methylphenoxy)butanamide.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(4-chloro-2-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 3355735 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethylideneamino]-4-(4-chloro-2-methylphenoxy)butanamide |
| SMILES | CC(=NNC(=O)CCCOc1ccc(Cl)cc1C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21ClN2O4/c1-13-10-16(21)6-8-17(13)25-9-3-4-20(24)23-22-14(2)15-5-7-18-19(11-15)27-12-26-18/h5-8,10-11H,3-4,9,12H2,1-2H3,(H,23,24) |
| InChIKey | MLVJXTBGBRZBSQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|