C26H25Cl2N3O3 — CID 4110646
4-chloro-N-[4-[N-[4-(4-chloro-2-methylphenoxy)butanoylamino]-C-methylcarbonimidoyl]phenyl]benzamide (PubChem CID 4110646) has the molecular formula C26H25Cl2N3O3 and a molecular weight of 498.41 g/mol. Its IUPAC name is 4-chloro-N-[4-[N-[4-(4-chloro-2-methylphenoxy)butanoylamino]-C-methylcarbonimidoyl]phenyl]benzamide.
| Compound Name | 4-chloro-N-[4-[N-[4-(4-chloro-2-methylphenoxy)butanoylamino]-C-methylcarbonimidoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4110646 |
| Molecular Formula | C26H25Cl2N3O3 |
| Molecular Weight | 498.41 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 4-chloro-N-[4-[N-[4-(4-chloro-2-methylphenoxy)butanoylamino]-C-methylcarbonimidoyl]phenyl]benzamide |
| SMILES | CC(=NNC(=O)CCCOc1ccc(Cl)cc1C)c1ccc(NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C26H25Cl2N3O3/c1-17-16-22(28)11-14-24(17)34-15-3-4-25(32)31-30-18(2)19-7-12-23(13-8-19)29-26(33)20-5-9-21(27)10-6-20/h5-14,16H,3-4,15H2,1-2H3,(H,29,33)(H,31,32) |
| InChIKey | KAEGSTDCBXXMEU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.41 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|