C16H15O3P — CID 158526920
1-(1,3-benzodioxol-5-yl)-3-phenylphosphanylpropan-2-one (PubChem CID 158526920) has the molecular formula C16H15O3P and a molecular weight of 286.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-phenylphosphanylpropan-2-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-phenylphosphanylpropan-2-one |
|---|---|
| PubChem CID | 158526920 |
| Molecular Formula | C16H15O3P |
| Molecular Weight | 286.27 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-phenylphosphanylpropan-2-one |
| SMILES | O=C(CPc1ccccc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15O3P/c17-13(10-20-14-4-2-1-3-5-14)8-12-6-7-15-16(9-12)19-11-18-15/h1-7,9,20H,8,10-11H2 |
| InChIKey | PLIKUTXUPRRGJX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|