C29H25NO3 — CID 11774905
N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2,2-triphenylacetamide (PubChem CID 11774905) has the molecular formula C29H25NO3 and a molecular weight of 435.52 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2,2-triphenylacetamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2,2-triphenylacetamide |
|---|---|
| PubChem CID | 11774905 |
| Molecular Formula | C29H25NO3 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,2,2-triphenylacetamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H25NO3/c31-28(30-19-18-22-16-17-26-27(20-22)33-21-32-26)29(23-10-4-1-5-11-23,24-12-6-2-7-13-24)25-14-8-3-9-15-25/h1-17,20H,18-19,21H2,(H,30,31) |
| InChIKey | RAJAREXHWJBZEG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|