C24H23NO3 — CID 56522758
3-(1,3-benzodioxol-5-yl)-N-(1,1-diphenylethyl)propanamide (PubChem CID 56522758) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(1,1-diphenylethyl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(1,1-diphenylethyl)propanamide |
|---|---|
| PubChem CID | 56522758 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(1,1-diphenylethyl)propanamide |
| SMILES | CC(NC(=O)CCc1ccc2c(c1)OCO2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c1-24(19-8-4-2-5-9-19,20-10-6-3-7-11-20)25-23(26)15-13-18-12-14-21-22(16-18)28-17-27-21/h2-12,14,16H,13,15,17H2,1H3,(H,25,26) |
| InChIKey | IQOQDXBXDBKYKO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |