C19H19NO5 — CID 95152788
methyl (2R)-2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-2-phenylacetate (PubChem CID 95152788) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is methyl (2R)-2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-2-phenylacetate.
| Compound Name | methyl (2R)-2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 95152788 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | methyl (2R)-2-[3-(1,3-benzodioxol-5-yl)propanoylamino]-2-phenylacetate |
| SMILES | COC(=O)[C@H](NC(=O)CCc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C19H19NO5/c1-23-19(22)18(14-5-3-2-4-6-14)20-17(21)10-8-13-7-9-15-16(11-13)25-12-24-15/h2-7,9,11,18H,8,10,12H2,1H3,(H,20,21)/t18-/m1/s1 |
| InChIKey | NTFXFXDSUSHQDG-GOSISDBHSA-N |
| XLogP | 2.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |