C23H21NO3 — CID 51276777
N-benzhydryl-3-(1,3-benzodioxol-5-yl)propanamide (PubChem CID 51276777) has the molecular formula C23H21NO3 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-benzhydryl-3-(1,3-benzodioxol-5-yl)propanamide.
| Compound Name | N-benzhydryl-3-(1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 51276777 |
| Molecular Formula | C23H21NO3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-benzhydryl-3-(1,3-benzodioxol-5-yl)propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO3/c25-22(14-12-17-11-13-20-21(15-17)27-16-26-20)24-23(18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1-11,13,15,23H,12,14,16H2,(H,24,25) |
| InChIKey | YLJSHOXUKYNMMD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |