C22H19NO3 — CID 56522895
N-(1,1-diphenylethyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 56522895) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(1,1-diphenylethyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 56522895 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N-(1,1-diphenylethyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(NC(=O)c1ccc2c(c1)OCO2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NO3/c1-22(17-8-4-2-5-9-17,18-10-6-3-7-11-18)23-21(24)16-12-13-19-20(14-16)26-15-25-19/h2-14H,15H2,1H3,(H,23,24) |
| InChIKey | WNTPVLNELHOBCM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |