C15H13NO5 — CID 175362662
1,3-benzodioxole-5-carboxamide;benzoic acid (PubChem CID 175362662) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1,3-benzodioxole-5-carboxamide;benzoic acid.
| Compound Name | 1,3-benzodioxole-5-carboxamide;benzoic acid |
|---|---|
| PubChem CID | 175362662 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | 1,3-benzodioxole-5-carboxamide;benzoic acid |
| SMILES | NC(=O)c1ccc2c(c1)OCO2.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C8H7NO3.C7H6O2/c9-8(10)5-1-2-6-7(3-5)12-4-11-6;8-7(9)6-4-2-1-3-5-6/h1-3H,4H2,(H2,9,10);1-5H,(H,8,9) |
| InChIKey | SQLIQWQBFTUIBJ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |