1,3-benzodioxole-5-carboxamide;benzoic acid

C15H13NO5 — CID 175362662

IUPAC1,3-benzodioxole-5-carboxamide;benzoic acid
SMILESNC(=O)c1ccc2c(c1)OCO2.O=C(O)c1ccccc1
InChIInChI=1S/C8H7NO3.C7H6O2/c9-8(10)5-1-2-6-7(3-5)12-4-11-6;8-7(9)6-4-2-1-3-5-6/h1-3H,4H2,(H2,9,10);1-5H,(H,8,9)
InChIKeySQLIQWQBFTUIBJ-UHFFFAOYSA-N
MW287.27 g/mol
LogP1.90
Rot. Bonds2

About 1,3-benzodioxole-5-carboxamide;benzoic acid

1,3-benzodioxole-5-carboxamide;benzoic acid (PubChem CID 175362662) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1,3-benzodioxole-5-carboxamide;benzoic acid.

Molecular Properties

Compound Name1,3-benzodioxole-5-carboxamide;benzoic acid
PubChem CID175362662
Molecular FormulaC15H13NO5
Molecular Weight287.27 g/mol
Exact Mass287.08
IUPAC Name1,3-benzodioxole-5-carboxamide;benzoic acid
SMILESNC(=O)c1ccc2c(c1)OCO2.O=C(O)c1ccccc1
InChIInChI=1S/C8H7NO3.C7H6O2/c9-8(10)5-1-2-6-7(3-5)12-4-11-6;8-7(9)6-4-2-1-3-5-6/h1-3H,4H2,(H2,9,10);1-5H,(H,8,9)
InChIKeySQLIQWQBFTUIBJ-UHFFFAOYSA-N
XLogP1.90
TPSA98.85 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.27
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1,3-benzodioxole-5-carboxamide;benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,3-benzodioxole-5-carboxamide;benzoic acid?
The IUPAC name of 1,3-benzodioxole-5-carboxamide;benzoic acid (CID 175362662) is 1,3-benzodioxole-5-carboxamide;benzoic acid.
What is the SMILES notation for 1,3-benzodioxole-5-carboxamide;benzoic acid?
The canonical SMILES for 1,3-benzodioxole-5-carboxamide;benzoic acid is NC(=O)c1ccc2c(c1)OCO2.O=C(O)c1ccccc1.
What is the InChIKey of 1,3-benzodioxole-5-carboxamide;benzoic acid?
The InChIKey is SQLIQWQBFTUIBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO3.C7H6O2/c9-8(10)5-1-2-6-7(3-5)12-4-11-6;8-7(9)6-4-2-1-3-5-6/h1-3H,4H2,(H2,9,10);1-5H,(H,8,9).
What are the key properties of 1,3-benzodioxole-5-carboxamide;benzoic acid?
1,3-benzodioxole-5-carboxamide;benzoic acid has a molecular weight of 287.27 g/mol, XLogP of 1.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzodioxole-5-carboxamide;benzoic acid is sourced from PubChem (CID 175362662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).