C22H15N3O4 — CID 11315141
2-[4-(1,3-benzodioxole-5-carbonyl)phenyl]-3H-benzimidazole-5-carboxamide (PubChem CID 11315141) has the molecular formula C22H15N3O4 and a molecular weight of 385.38 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxole-5-carbonyl)phenyl]-3H-benzimidazole-5-carboxamide.
| Compound Name | 2-[4-(1,3-benzodioxole-5-carbonyl)phenyl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 11315141 |
| Molecular Formula | C22H15N3O4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[4-(1,3-benzodioxole-5-carbonyl)phenyl]-3H-benzimidazole-5-carboxamide |
| SMILES | NC(=O)c1ccc2nc(-c3ccc(C(=O)c4ccc5c(c4)OCO5)cc3)[nH]c2c1 |
| InChI | InChI=1S/C22H15N3O4/c23-21(27)15-5-7-16-17(9-15)25-22(24-16)13-3-1-12(2-4-13)20(26)14-6-8-18-19(10-14)29-11-28-18/h1-10H,11H2,(H2,23,27)(H,24,25) |
| InChIKey | MDADHKRNWZRGBZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |